About N'-amino-N'-[(E)-cyclohexa-2,4-dien-1-ylideneamino]ethane-1,2-diamine
N'-amino-N'-[(E)-cyclohexa-2,4-dien-1-ylideneamino]ethane-1,2-diamine (PubChem CID 143513033) has the molecular formula C8H14N4
and a molecular weight of 166.23 g/mol. Its IUPAC name is N'-amino-N'-[(E)-cyclohexa-2,4-dien-1-ylideneamino]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-amino-N'-[(E)-cyclohexa-2,4-dien-1-ylideneamino]ethane-1,2-diamine |
| PubChem CID | 143513033 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | N'-amino-N'-[(E)-cyclohexa-2,4-dien-1-ylideneamino]ethane-1,2-diamine |
| SMILES | NCCN(N)/N=C1/C=CC=CC1 |
| InChI | InChI=1S/C8H14N4/c9-6-7-12(10)11-8-4-2-1-3-5-8/h1-4H,5-7,9-10H2/b11-8- |
| InChIKey | XYHWPTRFVUYZJV-FLIBITNWSA-N |
| XLogP | -0.01 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-amino-N'-[(E)-cyclohexa-2,4-dien-1-ylideneamino]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-amino-N'-[(E)-cyclohexa-2,4-dien-1-ylideneamino]ethane-1,2-diamine?
The IUPAC name of N'-amino-N'-[(E)-cyclohexa-2,4-dien-1-ylideneamino]ethane-1,2-diamine (CID 143513033) is N'-amino-N'-[(E)-cyclohexa-2,4-dien-1-ylideneamino]ethane-1,2-diamine.
What is the SMILES notation for N'-amino-N'-[(E)-cyclohexa-2,4-dien-1-ylideneamino]ethane-1,2-diamine?
The canonical SMILES for N'-amino-N'-[(E)-cyclohexa-2,4-dien-1-ylideneamino]ethane-1,2-diamine is NCCN(N)/N=C1/C=CC=CC1.
What is the InChIKey of N'-amino-N'-[(E)-cyclohexa-2,4-dien-1-ylideneamino]ethane-1,2-diamine?
The InChIKey is XYHWPTRFVUYZJV-FLIBITNWSA-N. The full InChI is InChI=1S/C8H14N4/c9-6-7-12(10)11-8-4-2-1-3-5-8/h1-4H,5-7,9-10H2/b11-8-.
What are the key properties of N'-amino-N'-[(E)-cyclohexa-2,4-dien-1-ylideneamino]ethane-1,2-diamine?
N'-amino-N'-[(E)-cyclohexa-2,4-dien-1-ylideneamino]ethane-1,2-diamine has a molecular weight of 166.23 g/mol, XLogP of -0.01, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-amino-N'-[(E)-cyclohexa-2,4-dien-1-ylideneamino]ethane-1,2-diamine is sourced from PubChem (CID 143513033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).