C29H34ClN7O2 — CID 143513068
N-tert-butyl-4-[13-chloro-10-[formamido-(3-methylimidazol-4-yl)methyl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperazine-1-carboxamide (PubChem CID 143513068) has the molecular formula C29H34ClN7O2 and a molecular weight of 548.09 g/mol. Its IUPAC name is N-tert-butyl-4-[13-chloro-10-[formamido-(3-methylimidazol-4-yl)methyl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperazine-1-carboxamide.
| Compound Name | N-tert-butyl-4-[13-chloro-10-[formamido-(3-methylimidazol-4-yl)methyl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 143513068 |
| Molecular Formula | C29H34ClN7O2 |
| Molecular Weight | 548.09 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | N-tert-butyl-4-[13-chloro-10-[formamido-(3-methylimidazol-4-yl)methyl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperazine-1-carboxamide |
| SMILES | Cn1cncc1C(NC=O)C1=Cc2cccnc2C(N2CCN(C(=O)NC(C)(C)C)CC2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C29H34ClN7O2/c1-29(2,3)34-28(39)37-12-10-36(11-13-37)27-21-8-7-20(30)15-22(21)23(14-19-6-5-9-32-25(19)27)26(33-18-38)24-16-31-17-35(24)4/h5-9,14-18,26-27H,10-13H2,1-4H3,(H,33,38)(H,34,39) |
| InChIKey | CXKIPPZJDRMEMO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.09 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|