About ethene;1-methoxy-2,2-dimethylpropane;piperazine-1-carbaldehyde
ethene;1-methoxy-2,2-dimethylpropane;piperazine-1-carbaldehyde (PubChem CID 143513109) has the molecular formula C13H28N2O2
and a molecular weight of 244.38 g/mol. Its IUPAC name is ethene;1-methoxy-2,2-dimethylpropane;piperazine-1-carbaldehyde.
Molecular Properties
| Compound Name | ethene;1-methoxy-2,2-dimethylpropane;piperazine-1-carbaldehyde |
| PubChem CID | 143513109 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | ethene;1-methoxy-2,2-dimethylpropane;piperazine-1-carbaldehyde |
| SMILES | C=C.COCC(C)(C)C.O=CN1CCNCC1 |
| InChI | InChI=1S/C6H14O.C5H10N2O.C2H4/c1-6(2,3)5-7-4;8-5-7-3-1-6-2-4-7;1-2/h5H2,1-4H3;5-6H,1-4H2;1-2H2 |
| InChIKey | HZYMNQLXHYBJJB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;1-methoxy-2,2-dimethylpropane;piperazine-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;1-methoxy-2,2-dimethylpropane;piperazine-1-carbaldehyde?
The IUPAC name of ethene;1-methoxy-2,2-dimethylpropane;piperazine-1-carbaldehyde (CID 143513109) is ethene;1-methoxy-2,2-dimethylpropane;piperazine-1-carbaldehyde.
What is the SMILES notation for ethene;1-methoxy-2,2-dimethylpropane;piperazine-1-carbaldehyde?
The canonical SMILES for ethene;1-methoxy-2,2-dimethylpropane;piperazine-1-carbaldehyde is C=C.COCC(C)(C)C.O=CN1CCNCC1.
What is the InChIKey of ethene;1-methoxy-2,2-dimethylpropane;piperazine-1-carbaldehyde?
The InChIKey is HZYMNQLXHYBJJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O.C5H10N2O.C2H4/c1-6(2,3)5-7-4;8-5-7-3-1-6-2-4-7;1-2/h5H2,1-4H3;5-6H,1-4H2;1-2H2.
What are the key properties of ethene;1-methoxy-2,2-dimethylpropane;piperazine-1-carbaldehyde?
ethene;1-methoxy-2,2-dimethylpropane;piperazine-1-carbaldehyde has a molecular weight of 244.38 g/mol, XLogP of 1.53, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;1-methoxy-2,2-dimethylpropane;piperazine-1-carbaldehyde is sourced from PubChem (CID 143513109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).