C21H21ClF2N6O — CID 143513246
(3R)-2-[2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-4-yl]-N-(2,2-difluoroethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide (PubChem CID 143513246) has the molecular formula C21H21ClF2N6O and a molecular weight of 446.89 g/mol. Its IUPAC name is (3R)-2-[2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-4-yl]-N-(2,2-difluoroethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | (3R)-2-[2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-4-yl]-N-(2,2-difluoroethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 143513246 |
| Molecular Formula | C21H21ClF2N6O |
| Molecular Weight | 446.89 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | (3R)-2-[2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-4-yl]-N-(2,2-difluoroethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
| SMILES | O=C(NCC(F)F)[C@H]1C2CCCC2CN1c1ccnc(-c2c[nH]c3ncc(Cl)cc23)n1 |
| InChI | InChI=1S/C21H21ClF2N6O/c22-12-6-14-15(8-27-19(14)26-7-12)20-25-5-4-17(29-20)30-10-11-2-1-3-13(11)18(30)21(31)28-9-16(23)24/h4-8,11,13,16,18H,1-3,9-10H2,(H,26,27)(H,28,31)/t11?,13?,18-/m1/s1 |
| InChIKey | BUZXFMWPZGEOPV-LJMKFJKQSA-N |
| XLogP | 3.66 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.89 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |