C25H22ClF2NO4S2 — CID 143513742
N-but-3-enyl-N-[(3S,4S)-4-(4-chlorophenyl)sulfonyl-5,8-difluoro-3,4-dihydro-2H-chromen-3-yl]-2-thiophen-2-ylacetamide (PubChem CID 143513742) has the molecular formula C25H22ClF2NO4S2 and a molecular weight of 538.04 g/mol. Its IUPAC name is N-but-3-enyl-N-[(3S,4S)-4-(4-chlorophenyl)sulfonyl-5,8-difluoro-3,4-dihydro-2H-chromen-3-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-but-3-enyl-N-[(3S,4S)-4-(4-chlorophenyl)sulfonyl-5,8-difluoro-3,4-dihydro-2H-chromen-3-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 143513742 |
| Molecular Formula | C25H22ClF2NO4S2 |
| Molecular Weight | 538.04 g/mol |
| Exact Mass | 537.06 |
| IUPAC Name | N-but-3-enyl-N-[(3S,4S)-4-(4-chlorophenyl)sulfonyl-5,8-difluoro-3,4-dihydro-2H-chromen-3-yl]-2-thiophen-2-ylacetamide |
| SMILES | C=CCCN(C(=O)Cc1cccs1)[C@H]1COc2c(F)ccc(F)c2[C@@H]1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H22ClF2NO4S2/c1-2-3-12-29(22(30)14-17-5-4-13-34-17)21-15-33-24-20(28)11-10-19(27)23(24)25(21)35(31,32)18-8-6-16(26)7-9-18/h2,4-11,13,21,25H,1,3,12,14-15H2/t21-,25+/m0/s1 |
| InChIKey | YKSFEOBEGJKPGY-SQJMNOBHSA-N |
| XLogP | 5.60 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.04 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|