C21H21ClF2O3S — CID 143513986
(3S,4R)-4-(4-chlorophenyl)sulfonyl-5,8-difluoro-3-hex-5-enyl-3,4-dihydro-2H-chromene (PubChem CID 143513986) has the molecular formula C21H21ClF2O3S and a molecular weight of 426.91 g/mol. Its IUPAC name is (3S,4R)-4-(4-chlorophenyl)sulfonyl-5,8-difluoro-3-hex-5-enyl-3,4-dihydro-2H-chromene.
| Compound Name | (3S,4R)-4-(4-chlorophenyl)sulfonyl-5,8-difluoro-3-hex-5-enyl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 143513986 |
| Molecular Formula | C21H21ClF2O3S |
| Molecular Weight | 426.91 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | (3S,4R)-4-(4-chlorophenyl)sulfonyl-5,8-difluoro-3-hex-5-enyl-3,4-dihydro-2H-chromene |
| SMILES | C=CCCCC[C@H]1COc2c(F)ccc(F)c2[C@@H]1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H21ClF2O3S/c1-2-3-4-5-6-14-13-27-20-18(24)12-11-17(23)19(20)21(14)28(25,26)16-9-7-15(22)8-10-16/h2,7-12,14,21H,1,3-6,13H2/t14-,21+/m0/s1 |
| InChIKey | PMKCESQWOGQQQR-LHSJRXKWSA-N |
| XLogP | 5.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.91 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|