C14H16F2O2 — CID 143514062
(1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-10a-yl)methanol (PubChem CID 143514062) has the molecular formula C14H16F2O2 and a molecular weight of 254.28 g/mol. Its IUPAC name is (1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-10a-yl)methanol.
| Compound Name | (1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-10a-yl)methanol |
|---|---|
| PubChem CID | 143514062 |
| Molecular Formula | C14H16F2O2 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | (1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-10a-yl)methanol |
| SMILES | OCC12CCCCC1COc1c(F)ccc(F)c12 |
| InChI | InChI=1S/C14H16F2O2/c15-10-4-5-11(16)13-12(10)14(8-17)6-2-1-3-9(14)7-18-13/h4-5,9,17H,1-3,6-8H2 |
| InChIKey | BBULXXATYFXCFF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |