About 5,8-difluoro-4-[(4-methylphenyl)sulfonylmethyl]-3,4-dihydro-2H-chromene
5,8-difluoro-4-[(4-methylphenyl)sulfonylmethyl]-3,4-dihydro-2H-chromene (PubChem CID 143514151) has the molecular formula C17H16F2O3S
and a molecular weight of 338.38 g/mol. Its IUPAC name is 5,8-difluoro-4-[(4-methylphenyl)sulfonylmethyl]-3,4-dihydro-2H-chromene.
Molecular Properties
| Compound Name | 5,8-difluoro-4-[(4-methylphenyl)sulfonylmethyl]-3,4-dihydro-2H-chromene |
| PubChem CID | 143514151 |
| Molecular Formula | C17H16F2O3S |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 5,8-difluoro-4-[(4-methylphenyl)sulfonylmethyl]-3,4-dihydro-2H-chromene |
| SMILES | Cc1ccc(S(=O)(=O)CC2CCOc3c(F)ccc(F)c32)cc1 |
| InChI | InChI=1S/C17H16F2O3S/c1-11-2-4-13(5-3-11)23(20,21)10-12-8-9-22-17-15(19)7-6-14(18)16(12)17/h2-7,12H,8-10H2,1H3 |
| InChIKey | GQRLJKIHLFZQRB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,8-difluoro-4-[(4-methylphenyl)sulfonylmethyl]-3,4-dihydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-difluoro-4-[(4-methylphenyl)sulfonylmethyl]-3,4-dihydro-2H-chromene?
The IUPAC name of 5,8-difluoro-4-[(4-methylphenyl)sulfonylmethyl]-3,4-dihydro-2H-chromene (CID 143514151) is 5,8-difluoro-4-[(4-methylphenyl)sulfonylmethyl]-3,4-dihydro-2H-chromene.
What is the SMILES notation for 5,8-difluoro-4-[(4-methylphenyl)sulfonylmethyl]-3,4-dihydro-2H-chromene?
The canonical SMILES for 5,8-difluoro-4-[(4-methylphenyl)sulfonylmethyl]-3,4-dihydro-2H-chromene is Cc1ccc(S(=O)(=O)CC2CCOc3c(F)ccc(F)c32)cc1.
What is the InChIKey of 5,8-difluoro-4-[(4-methylphenyl)sulfonylmethyl]-3,4-dihydro-2H-chromene?
The InChIKey is GQRLJKIHLFZQRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16F2O3S/c1-11-2-4-13(5-3-11)23(20,21)10-12-8-9-22-17-15(19)7-6-14(18)16(12)17/h2-7,12H,8-10H2,1H3.
What are the key properties of 5,8-difluoro-4-[(4-methylphenyl)sulfonylmethyl]-3,4-dihydro-2H-chromene?
5,8-difluoro-4-[(4-methylphenyl)sulfonylmethyl]-3,4-dihydro-2H-chromene has a molecular weight of 338.38 g/mol, XLogP of 3.61, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-difluoro-4-[(4-methylphenyl)sulfonylmethyl]-3,4-dihydro-2H-chromene is sourced from PubChem (CID 143514151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).