About 5-[(2E)-5-methylhexa-2,4-dien-2-yl]pyrimidine
5-[(2E)-5-methylhexa-2,4-dien-2-yl]pyrimidine (PubChem CID 143514991) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is 5-[(2E)-5-methylhexa-2,4-dien-2-yl]pyrimidine.
Molecular Properties
| Compound Name | 5-[(2E)-5-methylhexa-2,4-dien-2-yl]pyrimidine |
| PubChem CID | 143514991 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 5-[(2E)-5-methylhexa-2,4-dien-2-yl]pyrimidine |
| SMILES | CC(C)=C/C=C(\C)c1cncnc1 |
| InChI | InChI=1S/C11H14N2/c1-9(2)4-5-10(3)11-6-12-8-13-7-11/h4-8H,1-3H3/b10-5+ |
| InChIKey | QVWJIWIEMKORFQ-BJMVGYQFSA-N |
| XLogP | 2.85 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2E)-5-methylhexa-2,4-dien-2-yl]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2E)-5-methylhexa-2,4-dien-2-yl]pyrimidine?
The IUPAC name of 5-[(2E)-5-methylhexa-2,4-dien-2-yl]pyrimidine (CID 143514991) is 5-[(2E)-5-methylhexa-2,4-dien-2-yl]pyrimidine.
What is the SMILES notation for 5-[(2E)-5-methylhexa-2,4-dien-2-yl]pyrimidine?
The canonical SMILES for 5-[(2E)-5-methylhexa-2,4-dien-2-yl]pyrimidine is CC(C)=C/C=C(\C)c1cncnc1.
What is the InChIKey of 5-[(2E)-5-methylhexa-2,4-dien-2-yl]pyrimidine?
The InChIKey is QVWJIWIEMKORFQ-BJMVGYQFSA-N. The full InChI is InChI=1S/C11H14N2/c1-9(2)4-5-10(3)11-6-12-8-13-7-11/h4-8H,1-3H3/b10-5+.
What are the key properties of 5-[(2E)-5-methylhexa-2,4-dien-2-yl]pyrimidine?
5-[(2E)-5-methylhexa-2,4-dien-2-yl]pyrimidine has a molecular weight of 174.25 g/mol, XLogP of 2.85, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2E)-5-methylhexa-2,4-dien-2-yl]pyrimidine is sourced from PubChem (CID 143514991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).