C22H21F4N5O3 — CID 143515388
N-[5-[(Z)-(5-fluoro-7-formamido-2-oxo-1H-indol-3-ylidene)methyl]-2-methyl-4-(trifluoromethyl)-1H-pyrrol-3-yl]piperidine-1-carboxamide (PubChem CID 143515388) has the molecular formula C22H21F4N5O3 and a molecular weight of 479.43 g/mol. Its IUPAC name is N-[5-[(Z)-(5-fluoro-7-formamido-2-oxo-1H-indol-3-ylidene)methyl]-2-methyl-4-(trifluoromethyl)-1H-pyrrol-3-yl]piperidine-1-carboxamide.
| Compound Name | N-[5-[(Z)-(5-fluoro-7-formamido-2-oxo-1H-indol-3-ylidene)methyl]-2-methyl-4-(trifluoromethyl)-1H-pyrrol-3-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 143515388 |
| Molecular Formula | C22H21F4N5O3 |
| Molecular Weight | 479.43 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | N-[5-[(Z)-(5-fluoro-7-formamido-2-oxo-1H-indol-3-ylidene)methyl]-2-methyl-4-(trifluoromethyl)-1H-pyrrol-3-yl]piperidine-1-carboxamide |
| SMILES | Cc1[nH]c(/C=C2\C(=O)Nc3c(NC=O)cc(F)cc32)c(C(F)(F)F)c1NC(=O)N1CCCCC1 |
| InChI | InChI=1S/C22H21F4N5O3/c1-11-18(30-21(34)31-5-3-2-4-6-31)17(22(24,25)26)15(28-11)9-14-13-7-12(23)8-16(27-10-32)19(13)29-20(14)33/h7-10,28H,2-6H2,1H3,(H,27,32)(H,29,33)(H,30,34)/b14-9- |
| InChIKey | FNOKOFHFZLBIGB-ZROIWOOFSA-N |
| XLogP | 4.56 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.43 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|