C21H25FN8O — CID 143515522
4-N-[4-[3-amino-2-methanimidoyl-N-(3-methoxypropyl)anilino]-5-fluoropyrimidin-2-yl]benzene-1,2,4-triamine (PubChem CID 143515522) has the molecular formula C21H25FN8O and a molecular weight of 424.48 g/mol. Its IUPAC name is 4-N-[4-[3-amino-2-methanimidoyl-N-(3-methoxypropyl)anilino]-5-fluoropyrimidin-2-yl]benzene-1,2,4-triamine.
| Compound Name | 4-N-[4-[3-amino-2-methanimidoyl-N-(3-methoxypropyl)anilino]-5-fluoropyrimidin-2-yl]benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 143515522 |
| Molecular Formula | C21H25FN8O |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 4-N-[4-[3-amino-2-methanimidoyl-N-(3-methoxypropyl)anilino]-5-fluoropyrimidin-2-yl]benzene-1,2,4-triamine |
| SMILES | [H]/N=C/c1c(N)cccc1N(CCCOC)c1nc(Nc2ccc(N)c(N)c2)ncc1F |
| InChI | InChI=1S/C21H25FN8O/c1-31-9-3-8-30(19-5-2-4-16(24)14(19)11-23)20-15(22)12-27-21(29-20)28-13-6-7-17(25)18(26)10-13/h2,4-7,10-12,23H,3,8-9,24-26H2,1H3,(H,27,28,29)/b23-11+ |
| InChIKey | MAAXZLICUBJQJO-FOKLQQMPSA-N |
| XLogP | 3.28 |
| TPSA | 152.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|