C42H44N2 — CID 143515977
N-[(E)-but-2-en-2-yl]-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-[4-[4-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]-[(3E)-hexa-1,3,5-trien-3-yl]amino]phenyl]phenyl]aniline (PubChem CID 143515977) has the molecular formula C42H44N2 and a molecular weight of 576.83 g/mol. Its IUPAC name is N-[(E)-but-2-en-2-yl]-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-[4-[4-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]-[(3E)-hexa-1,3,5-trien-3-yl]amino]phenyl]phenyl]aniline.
| Compound Name | N-[(E)-but-2-en-2-yl]-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-[4-[4-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]-[(3E)-hexa-1,3,5-trien-3-yl]amino]phenyl]phenyl]aniline |
|---|---|
| PubChem CID | 143515977 |
| Molecular Formula | C42H44N2 |
| Molecular Weight | 576.83 g/mol |
| Exact Mass | 576.35 |
| IUPAC Name | N-[(E)-but-2-en-2-yl]-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-[4-[4-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]-[(3E)-hexa-1,3,5-trien-3-yl]amino]phenyl]phenyl]aniline |
| SMILES | C=C/C=C(\C=C)N(C(/C=C\C)=C/C=C)c1ccc(-c2ccc(-c3ccc(N(/C(C)=C/C)C(/C=C\C)=C/C=C)cc3)cc2)cc1 |
| InChI | InChI=1S/C42H44N2/c1-9-16-38(15-7)44(40(19-12-4)20-13-5)42-31-27-37(28-32-42)35-23-21-34(22-24-35)36-25-29-41(30-26-36)43(33(8)14-6)39(17-10-2)18-11-3/h9-32H,1-2,4,7H2,3,5-6,8H3/b18-11-,20-13-,33-14+,38-16+,39-17+,40-19+ |
| InChIKey | ZFZOJQTWBHNFOR-LKBYSTDDSA-N |
| XLogP | 12.10 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.83 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|