C33H32N2 — CID 143516094
3-[(Z)-but-1-enyl]-N-but-1-en-2-yl-2-methyl-1-naphthalen-2-yl-N-phenylindol-5-amine (PubChem CID 143516094) has the molecular formula C33H32N2 and a molecular weight of 456.63 g/mol. Its IUPAC name is 3-[(Z)-but-1-enyl]-N-but-1-en-2-yl-2-methyl-1-naphthalen-2-yl-N-phenylindol-5-amine.
| Compound Name | 3-[(Z)-but-1-enyl]-N-but-1-en-2-yl-2-methyl-1-naphthalen-2-yl-N-phenylindol-5-amine |
|---|---|
| PubChem CID | 143516094 |
| Molecular Formula | C33H32N2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | 3-[(Z)-but-1-enyl]-N-but-1-en-2-yl-2-methyl-1-naphthalen-2-yl-N-phenylindol-5-amine |
| SMILES | C=C(CC)N(c1ccccc1)c1ccc2c(c1)c(/C=C\CC)c(C)n2-c1ccc2ccccc2c1 |
| InChI | InChI=1S/C33H32N2/c1-5-7-17-31-25(4)35(29-19-18-26-13-11-12-14-27(26)22-29)33-21-20-30(23-32(31)33)34(24(3)6-2)28-15-9-8-10-16-28/h7-23H,3,5-6H2,1-2,4H3/b17-7- |
| InChIKey | GMCJZGJURRHXPP-IDUWFGFVSA-N |
| XLogP | 9.58 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |