C16H20N6O4 — CID 143516284
ethyl 2-[4-[2-[(diaminomethylidenecarbamoylamino)methyl]-1H-imidazol-5-yl]phenoxy]acetate (PubChem CID 143516284) has the molecular formula C16H20N6O4 and a molecular weight of 360.37 g/mol. Its IUPAC name is ethyl 2-[4-[2-[(diaminomethylidenecarbamoylamino)methyl]-1H-imidazol-5-yl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[2-[(diaminomethylidenecarbamoylamino)methyl]-1H-imidazol-5-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 143516284 |
| Molecular Formula | C16H20N6O4 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | ethyl 2-[4-[2-[(diaminomethylidenecarbamoylamino)methyl]-1H-imidazol-5-yl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(-c2cnc(CNC(=O)N=C(N)N)[nH]2)cc1 |
| InChI | InChI=1S/C16H20N6O4/c1-2-25-14(23)9-26-11-5-3-10(4-6-11)12-7-19-13(21-12)8-20-16(24)22-15(17)18/h3-7H,2,8-9H2,1H3,(H,19,21)(H5,17,18,20,22,24) |
| InChIKey | YWLFSUXIGZDDGX-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 157.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|