C15H22N6O — CID 143516499
(E)-3-[6-amino-5-(piperidin-1-ylmethyl)-3-pyridinyl]-N-(diaminomethylidene)prop-2-enamide (PubChem CID 143516499) has the molecular formula C15H22N6O and a molecular weight of 302.38 g/mol. Its IUPAC name is (E)-3-[6-amino-5-(piperidin-1-ylmethyl)-3-pyridinyl]-N-(diaminomethylidene)prop-2-enamide.
| Compound Name | (E)-3-[6-amino-5-(piperidin-1-ylmethyl)-3-pyridinyl]-N-(diaminomethylidene)prop-2-enamide |
|---|---|
| PubChem CID | 143516499 |
| Molecular Formula | C15H22N6O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (E)-3-[6-amino-5-(piperidin-1-ylmethyl)-3-pyridinyl]-N-(diaminomethylidene)prop-2-enamide |
| SMILES | NC(N)=NC(=O)/C=C/c1cnc(N)c(CN2CCCCC2)c1 |
| InChI | InChI=1S/C15H22N6O/c16-14-12(10-21-6-2-1-3-7-21)8-11(9-19-14)4-5-13(22)20-15(17)18/h4-5,8-9H,1-3,6-7,10H2,(H2,16,19)(H4,17,18,20,22)/b5-4+ |
| InChIKey | HUVFWUSDUOGXHQ-SNAWJCMRSA-N |
| XLogP | 0.46 |
| TPSA | 123.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|