C26H20BeN2O2S+2 — CID 143516717
beryllium;benzo[h]quinolin-1-ium-10-olate;2-(1,3-benzothiazol-3-ium-2-yl)cyclohexa-1,5-dien-1-olate (PubChem CID 143516717) has the molecular formula C26H20BeN2O2S+2 and a molecular weight of 433.54 g/mol. Its IUPAC name is beryllium;benzo[h]quinolin-1-ium-10-olate;2-(1,3-benzothiazol-3-ium-2-yl)cyclohexa-1,5-dien-1-olate.
| Compound Name | beryllium;benzo[h]quinolin-1-ium-10-olate;2-(1,3-benzothiazol-3-ium-2-yl)cyclohexa-1,5-dien-1-olate |
|---|---|
| PubChem CID | 143516717 |
| Molecular Formula | C26H20BeN2O2S+2 |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | beryllium;benzo[h]quinolin-1-ium-10-olate;2-(1,3-benzothiazol-3-ium-2-yl)cyclohexa-1,5-dien-1-olate |
| SMILES | [Be+2].[O-]C1=C(c2[nH+]c3ccccc3s2)CCC=C1.[O-]c1cccc2ccc3ccc[nH+]c3c12 |
| InChI | InChI=1S/C13H11NOS.C13H9NO.Be/c15-11-7-3-1-5-9(11)13-14-10-6-2-4-8-12(10)16-13;15-11-5-1-3-9-6-7-10-4-2-8-14-13(10)12(9)11;/h2-4,6-8,15H,1,5H2;1-8,15H;/q;;+2 |
| InChIKey | SKCZERGFINKFLU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 74.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|