C37H27F3N2O9 — CID 14351693
[(2R,3R,4R,5S,6R)-3,4,5-tribenzoyloxy-6-cyano-1-(2,2,2-trifluoroacetyl)piperidin-2-yl]methyl benzoate (PubChem CID 14351693) has the molecular formula C37H27F3N2O9 and a molecular weight of 700.62 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6R)-3,4,5-tribenzoyloxy-6-cyano-1-(2,2,2-trifluoroacetyl)piperidin-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5S,6R)-3,4,5-tribenzoyloxy-6-cyano-1-(2,2,2-trifluoroacetyl)piperidin-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 14351693 |
| Molecular Formula | C37H27F3N2O9 |
| Molecular Weight | 700.62 g/mol |
| Exact Mass | 700.17 |
| IUPAC Name | [(2R,3R,4R,5S,6R)-3,4,5-tribenzoyloxy-6-cyano-1-(2,2,2-trifluoroacetyl)piperidin-2-yl]methyl benzoate |
| SMILES | N#C[C@@H]1[C@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@@H](COC(=O)c2ccccc2)N1C(=O)C(F)(F)F |
| InChI | InChI=1S/C37H27F3N2O9/c38-37(39,40)36(47)42-27(21-41)29(49-33(44)24-15-7-2-8-16-24)31(51-35(46)26-19-11-4-12-20-26)30(50-34(45)25-17-9-3-10-18-25)28(42)22-48-32(43)23-13-5-1-6-14-23/h1-20,27-31H,22H2/t27-,28-,29+,30-,31-/m1/s1 |
| InChIKey | OJPIDLYUGQBGDU-PXPWAULYSA-N |
| XLogP | 5.19 |
| TPSA | 149.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.62 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|