C23H21F6NO2 — CID 143517472
(7S)-6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-7-(2-methylphenyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 143517472) has the molecular formula C23H21F6NO2 and a molecular weight of 457.41 g/mol. Its IUPAC name is (7S)-6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-7-(2-methylphenyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | (7S)-6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-7-(2-methylphenyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 143517472 |
| Molecular Formula | C23H21F6NO2 |
| Molecular Weight | 457.41 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | (7S)-6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-7-(2-methylphenyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | Cc1ccccc1[C@@H]1C(OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)CN2C(=O)CCC12 |
| InChI | InChI=1S/C23H21F6NO2/c1-13-4-2-3-5-17(13)21-18-6-7-20(31)30(18)11-19(21)32-12-14-8-15(22(24,25)26)10-16(9-14)23(27,28)29/h2-5,8-10,18-19,21H,6-7,11-12H2,1H3/t18?,19?,21-/m0/s1 |
| InChIKey | DFYKSJOHJHRVCN-GRERDSQWSA-N |
| XLogP | 5.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.41 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |