C20H22F6N4 — CID 143517593
trans-(2R,5S)-5-[[3-methyl-2-(trifluoromethyl)-4,6-dihydropyrrolo[3,4-d]imidazol-5-yl]methyl]-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine (PubChem CID 143517593) has the molecular formula C20H22F6N4 and a molecular weight of 432.41 g/mol. Its IUPAC name is trans-(2R,5S)-5-[[3-methyl-2-(trifluoromethyl)-4,6-dihydropyrrolo[3,4-d]imidazol-5-yl]methyl]-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine.
| Compound Name | trans-(2R,5S)-5-[[3-methyl-2-(trifluoromethyl)-4,6-dihydropyrrolo[3,4-d]imidazol-5-yl]methyl]-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 143517593 |
| Molecular Formula | C20H22F6N4 |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | trans-(2R,5S)-5-[[3-methyl-2-(trifluoromethyl)-4,6-dihydropyrrolo[3,4-d]imidazol-5-yl]methyl]-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine |
| SMILES | Cn1c(C(F)(F)F)nc2c1CN(C[C@H]1CC[C@H](c3cc(F)c(F)cc3F)C(N)C1)C2 |
| InChI | InChI=1S/C20H22F6N4/c1-29-18-9-30(8-17(18)28-19(29)20(24,25)26)7-10-2-3-11(16(27)4-10)12-5-14(22)15(23)6-13(12)21/h5-6,10-11,16H,2-4,7-9,27H2,1H3/t10-,11+,16?/m0/s1 |
| InChIKey | XHQUTTUBOYANQO-BBXPGFNESA-N |
| XLogP | 4.08 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|