C32H28N6O — CID 143517700
N,5-dimethyl-6-[2-[4-[(4-phenylphthalazin-1-yl)methyl]phenoxy]-3-pyridinyl]-5,6-dihydro-1H-pyrimidin-2-imine (PubChem CID 143517700) has the molecular formula C32H28N6O and a molecular weight of 512.62 g/mol. Its IUPAC name is N,5-dimethyl-6-[2-[4-[(4-phenylphthalazin-1-yl)methyl]phenoxy]-3-pyridinyl]-5,6-dihydro-1H-pyrimidin-2-imine.
| Compound Name | N,5-dimethyl-6-[2-[4-[(4-phenylphthalazin-1-yl)methyl]phenoxy]-3-pyridinyl]-5,6-dihydro-1H-pyrimidin-2-imine |
|---|---|
| PubChem CID | 143517700 |
| Molecular Formula | C32H28N6O |
| Molecular Weight | 512.62 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | N,5-dimethyl-6-[2-[4-[(4-phenylphthalazin-1-yl)methyl]phenoxy]-3-pyridinyl]-5,6-dihydro-1H-pyrimidin-2-imine |
| SMILES | C/N=C1\N=CC(C)C(c2cccnc2Oc2ccc(Cc3nnc(-c4ccccc4)c4ccccc34)cc2)N1 |
| InChI | InChI=1S/C32H28N6O/c1-21-20-35-32(33-2)36-29(21)27-13-8-18-34-31(27)39-24-16-14-22(15-17-24)19-28-25-11-6-7-12-26(25)30(38-37-28)23-9-4-3-5-10-23/h3-18,20-21,29H,19H2,1-2H3,(H,33,36) |
| InChIKey | KKWJEJIZLSZPQA-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.62 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|