C28H32Cl2N2O3 — CID 143518394
3-(cyclopentylmethyl)-1-[2-(2,4-dichlorophenyl)ethyl]-8-(3-hydroxyphenyl)-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 143518394) has the molecular formula C28H32Cl2N2O3 and a molecular weight of 515.48 g/mol. Its IUPAC name is 3-(cyclopentylmethyl)-1-[2-(2,4-dichlorophenyl)ethyl]-8-(3-hydroxyphenyl)-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-(cyclopentylmethyl)-1-[2-(2,4-dichlorophenyl)ethyl]-8-(3-hydroxyphenyl)-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 143518394 |
| Molecular Formula | C28H32Cl2N2O3 |
| Molecular Weight | 515.48 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | 3-(cyclopentylmethyl)-1-[2-(2,4-dichlorophenyl)ethyl]-8-(3-hydroxyphenyl)-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1N(CC2CCCC2)C(=O)C2(CCC(c3cccc(O)c3)CC2)N1CCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C28H32Cl2N2O3/c29-23-9-8-21(25(30)17-23)12-15-32-27(35)31(18-19-4-1-2-5-19)26(34)28(32)13-10-20(11-14-28)22-6-3-7-24(33)16-22/h3,6-9,16-17,19-20,33H,1-2,4-5,10-15,18H2 |
| InChIKey | DPBMRVYPNVYHPM-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.48 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|