C26H40N6 — CID 143518552
1-[(1Z)-1-[4-(aminomethyl)-2-methylimidazol-1-yl]buta-1,3-dienyl]-N,N-dimethylazepan-4-amine;5,6,7,8-tetrahydroquinoline (PubChem CID 143518552) has the molecular formula C26H40N6 and a molecular weight of 436.65 g/mol. Its IUPAC name is 1-[(1Z)-1-[4-(aminomethyl)-2-methylimidazol-1-yl]buta-1,3-dienyl]-N,N-dimethylazepan-4-amine;5,6,7,8-tetrahydroquinoline.
| Compound Name | 1-[(1Z)-1-[4-(aminomethyl)-2-methylimidazol-1-yl]buta-1,3-dienyl]-N,N-dimethylazepan-4-amine;5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 143518552 |
| Molecular Formula | C26H40N6 |
| Molecular Weight | 436.65 g/mol |
| Exact Mass | 436.33 |
| IUPAC Name | 1-[(1Z)-1-[4-(aminomethyl)-2-methylimidazol-1-yl]buta-1,3-dienyl]-N,N-dimethylazepan-4-amine;5,6,7,8-tetrahydroquinoline |
| SMILES | C=C/C=C(/N1CCCC(N(C)C)CC1)n1cc(CN)nc1C.c1cnc2c(c1)CCCC2 |
| InChI | InChI=1S/C17H29N5.C9H11N/c1-5-7-17(22-13-15(12-18)19-14(22)2)21-10-6-8-16(9-11-21)20(3)4;1-2-6-9-8(4-1)5-3-7-10-9/h5,7,13,16H,1,6,8-12,18H2,2-4H3;3,5,7H,1-2,4,6H2/b17-7-; |
| InChIKey | BNFPJFHYFHFFQU-TULZRXOXSA-N |
| XLogP | 4.01 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.65 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|