C20H29BrN4 — CID 143518631
N-[[1-(1-bromobut-3-enyl)imidazol-4-yl]methyl]-N-methyl-5,6,7,8-tetrahydroquinolin-8-amine;ethane (PubChem CID 143518631) has the molecular formula C20H29BrN4 and a molecular weight of 405.38 g/mol. Its IUPAC name is N-[[1-(1-bromobut-3-enyl)imidazol-4-yl]methyl]-N-methyl-5,6,7,8-tetrahydroquinolin-8-amine;ethane.
| Compound Name | N-[[1-(1-bromobut-3-enyl)imidazol-4-yl]methyl]-N-methyl-5,6,7,8-tetrahydroquinolin-8-amine;ethane |
|---|---|
| PubChem CID | 143518631 |
| Molecular Formula | C20H29BrN4 |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | N-[[1-(1-bromobut-3-enyl)imidazol-4-yl]methyl]-N-methyl-5,6,7,8-tetrahydroquinolin-8-amine;ethane |
| SMILES | C=CCC(Br)n1cnc(CN(C)C2CCCc3cccnc32)c1.CC |
| InChI | InChI=1S/C18H23BrN4.C2H6/c1-3-6-17(19)23-12-15(21-13-23)11-22(2)16-9-4-7-14-8-5-10-20-18(14)16;1-2/h3,5,8,10,12-13,16-17H,1,4,6-7,9,11H2,2H3;1-2H3 |
| InChIKey | FWAGSDBWCROJDY-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|