About 5-(4-ethenylpiperidin-1-yl)-2,3-dimethyl-4H-pyrimidine
5-(4-ethenylpiperidin-1-yl)-2,3-dimethyl-4H-pyrimidine (PubChem CID 143519239) has the molecular formula C13H21N3
and a molecular weight of 219.33 g/mol. Its IUPAC name is 5-(4-ethenylpiperidin-1-yl)-2,3-dimethyl-4H-pyrimidine.
Molecular Properties
| Compound Name | 5-(4-ethenylpiperidin-1-yl)-2,3-dimethyl-4H-pyrimidine |
| PubChem CID | 143519239 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 5-(4-ethenylpiperidin-1-yl)-2,3-dimethyl-4H-pyrimidine |
| SMILES | C=CC1CCN(C2=CN=C(C)N(C)C2)CC1 |
| InChI | InChI=1S/C13H21N3/c1-4-12-5-7-16(8-6-12)13-9-14-11(2)15(3)10-13/h4,9,12H,1,5-8,10H2,2-3H3 |
| InChIKey | VIXDWLRYHUIBEP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-ethenylpiperidin-1-yl)-2,3-dimethyl-4H-pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-ethenylpiperidin-1-yl)-2,3-dimethyl-4H-pyrimidine?
The IUPAC name of 5-(4-ethenylpiperidin-1-yl)-2,3-dimethyl-4H-pyrimidine (CID 143519239) is 5-(4-ethenylpiperidin-1-yl)-2,3-dimethyl-4H-pyrimidine.
What is the SMILES notation for 5-(4-ethenylpiperidin-1-yl)-2,3-dimethyl-4H-pyrimidine?
The canonical SMILES for 5-(4-ethenylpiperidin-1-yl)-2,3-dimethyl-4H-pyrimidine is C=CC1CCN(C2=CN=C(C)N(C)C2)CC1.
What is the InChIKey of 5-(4-ethenylpiperidin-1-yl)-2,3-dimethyl-4H-pyrimidine?
The InChIKey is VIXDWLRYHUIBEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3/c1-4-12-5-7-16(8-6-12)13-9-14-11(2)15(3)10-13/h4,9,12H,1,5-8,10H2,2-3H3.
What are the key properties of 5-(4-ethenylpiperidin-1-yl)-2,3-dimethyl-4H-pyrimidine?
5-(4-ethenylpiperidin-1-yl)-2,3-dimethyl-4H-pyrimidine has a molecular weight of 219.33 g/mol, XLogP of 2.09, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-ethenylpiperidin-1-yl)-2,3-dimethyl-4H-pyrimidine is sourced from PubChem (CID 143519239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).