About (4-methylphenyl) (NE,1E)-N-butan-2-ylideneethanehydrazonate
(4-methylphenyl) (NE,1E)-N-butan-2-ylideneethanehydrazonate (PubChem CID 143519446) has the molecular formula C13H18N2O
and a molecular weight of 218.30 g/mol. Its IUPAC name is (4-methylphenyl) (NE,1E)-N-butan-2-ylideneethanehydrazonate.
Molecular Properties
| Compound Name | (4-methylphenyl) (NE,1E)-N-butan-2-ylideneethanehydrazonate |
| PubChem CID | 143519446 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | (4-methylphenyl) (NE,1E)-N-butan-2-ylideneethanehydrazonate |
| SMILES | CC/C(C)=N/N=C(\C)Oc1ccc(C)cc1 |
| InChI | InChI=1S/C13H18N2O/c1-5-11(3)14-15-12(4)16-13-8-6-10(2)7-9-13/h6-9H,5H2,1-4H3/b14-11+,15-12+ |
| InChIKey | IFXLCGLEFAOSPU-LCPPQYOVSA-N |
| XLogP | 3.58 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenyl) (NE,1E)-N-butan-2-ylideneethanehydrazonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl) (NE,1E)-N-butan-2-ylideneethanehydrazonate?
The IUPAC name of (4-methylphenyl) (NE,1E)-N-butan-2-ylideneethanehydrazonate (CID 143519446) is (4-methylphenyl) (NE,1E)-N-butan-2-ylideneethanehydrazonate.
What is the SMILES notation for (4-methylphenyl) (NE,1E)-N-butan-2-ylideneethanehydrazonate?
The canonical SMILES for (4-methylphenyl) (NE,1E)-N-butan-2-ylideneethanehydrazonate is CC/C(C)=N/N=C(\C)Oc1ccc(C)cc1.
What is the InChIKey of (4-methylphenyl) (NE,1E)-N-butan-2-ylideneethanehydrazonate?
The InChIKey is IFXLCGLEFAOSPU-LCPPQYOVSA-N. The full InChI is InChI=1S/C13H18N2O/c1-5-11(3)14-15-12(4)16-13-8-6-10(2)7-9-13/h6-9H,5H2,1-4H3/b14-11+,15-12+.
What are the key properties of (4-methylphenyl) (NE,1E)-N-butan-2-ylideneethanehydrazonate?
(4-methylphenyl) (NE,1E)-N-butan-2-ylideneethanehydrazonate has a molecular weight of 218.30 g/mol, XLogP of 3.58, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl) (NE,1E)-N-butan-2-ylideneethanehydrazonate is sourced from PubChem (CID 143519446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).