About 4-methoxy-5-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine;methylcyclopropane
4-methoxy-5-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine;methylcyclopropane (PubChem CID 143519467) has the molecular formula C12H17F3N2O2
and a molecular weight of 278.27 g/mol. Its IUPAC name is 4-methoxy-5-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine;methylcyclopropane.
Molecular Properties
| Compound Name | 4-methoxy-5-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine;methylcyclopropane |
| PubChem CID | 143519467 |
| Molecular Formula | C12H17F3N2O2 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 4-methoxy-5-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine;methylcyclopropane |
| SMILES | CC1CC1.COc1ncnc(OCC(F)(F)F)c1C |
| InChI | InChI=1S/C8H9F3N2O2.C4H8/c1-5-6(14-2)12-4-13-7(5)15-3-8(9,10)11;1-4-2-3-4/h4H,3H2,1-2H3;4H,2-3H2,1H3 |
| InChIKey | YLFYWTHHHXIRNW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methoxy-5-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine;methylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-5-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine;methylcyclopropane?
The IUPAC name of 4-methoxy-5-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine;methylcyclopropane (CID 143519467) is 4-methoxy-5-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine;methylcyclopropane.
What is the SMILES notation for 4-methoxy-5-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine;methylcyclopropane?
The canonical SMILES for 4-methoxy-5-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine;methylcyclopropane is CC1CC1.COc1ncnc(OCC(F)(F)F)c1C.
What is the InChIKey of 4-methoxy-5-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine;methylcyclopropane?
The InChIKey is YLFYWTHHHXIRNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3N2O2.C4H8/c1-5-6(14-2)12-4-13-7(5)15-3-8(9,10)11;1-4-2-3-4/h4H,3H2,1-2H3;4H,2-3H2,1H3.
What are the key properties of 4-methoxy-5-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine;methylcyclopropane?
4-methoxy-5-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine;methylcyclopropane has a molecular weight of 278.27 g/mol, XLogP of 3.15, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-5-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine;methylcyclopropane is sourced from PubChem (CID 143519467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).