C19H21N3OS — CID 143519784
[(E)-prop-1-enyl] N'-[4-(5,6,7,8-tetrahydronaphthalen-1-yloxy)-2-pyridinyl]carbamimidothioate (PubChem CID 143519784) has the molecular formula C19H21N3OS and a molecular weight of 339.46 g/mol. Its IUPAC name is [(E)-prop-1-enyl] N'-[4-(5,6,7,8-tetrahydronaphthalen-1-yloxy)-2-pyridinyl]carbamimidothioate.
| Compound Name | [(E)-prop-1-enyl] N'-[4-(5,6,7,8-tetrahydronaphthalen-1-yloxy)-2-pyridinyl]carbamimidothioate |
|---|---|
| PubChem CID | 143519784 |
| Molecular Formula | C19H21N3OS |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | [(E)-prop-1-enyl] N'-[4-(5,6,7,8-tetrahydronaphthalen-1-yloxy)-2-pyridinyl]carbamimidothioate |
| SMILES | C/C=C/S/C(N)=N/c1cc(Oc2cccc3c2CCCC3)ccn1 |
| InChI | InChI=1S/C19H21N3OS/c1-2-12-24-19(20)22-18-13-15(10-11-21-18)23-17-9-5-7-14-6-3-4-8-16(14)17/h2,5,7,9-13H,3-4,6,8H2,1H3,(H2,20,21,22)/b12-2+ |
| InChIKey | AMNMZIMVSPZYFN-SWGQDTFXSA-N |
| XLogP | 4.97 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|