C22H14ClF3N2O2S — CID 143520110
3-chloro-4,7-difluoro-N-[[5-(2-fluoro-4-pyridinyl)-2-methoxyphenyl]methyl]-1-benzothiophene-2-carboxamide (PubChem CID 143520110) has the molecular formula C22H14ClF3N2O2S and a molecular weight of 462.88 g/mol. Its IUPAC name is 3-chloro-4,7-difluoro-N-[[5-(2-fluoro-4-pyridinyl)-2-methoxyphenyl]methyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-4,7-difluoro-N-[[5-(2-fluoro-4-pyridinyl)-2-methoxyphenyl]methyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 143520110 |
| Molecular Formula | C22H14ClF3N2O2S |
| Molecular Weight | 462.88 g/mol |
| Exact Mass | 462.04 |
| IUPAC Name | 3-chloro-4,7-difluoro-N-[[5-(2-fluoro-4-pyridinyl)-2-methoxyphenyl]methyl]-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc(-c2ccnc(F)c2)cc1CNC(=O)c1sc2c(F)ccc(F)c2c1Cl |
| InChI | InChI=1S/C22H14ClF3N2O2S/c1-30-16-5-2-11(12-6-7-27-17(26)9-12)8-13(16)10-28-22(29)21-19(23)18-14(24)3-4-15(25)20(18)31-21/h2-9H,10H2,1H3,(H,28,29) |
| InChIKey | QTMIRRIEPPDUKV-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.88 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|