C20H21Cl2N3 — CID 143520386
2-(2,4-dichlorophenyl)-3-(2-pyridin-3-ylpropyl)pyridine;methanamine (PubChem CID 143520386) has the molecular formula C20H21Cl2N3 and a molecular weight of 374.32 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-3-(2-pyridin-3-ylpropyl)pyridine;methanamine.
| Compound Name | 2-(2,4-dichlorophenyl)-3-(2-pyridin-3-ylpropyl)pyridine;methanamine |
|---|---|
| PubChem CID | 143520386 |
| Molecular Formula | C20H21Cl2N3 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-3-(2-pyridin-3-ylpropyl)pyridine;methanamine |
| SMILES | CC(Cc1cccnc1-c1ccc(Cl)cc1Cl)c1cccnc1.CN |
| InChI | InChI=1S/C19H16Cl2N2.CH5N/c1-13(15-5-2-8-22-12-15)10-14-4-3-9-23-19(14)17-7-6-16(20)11-18(17)21;1-2/h2-9,11-13H,10H2,1H3;2H2,1H3 |
| InChIKey | XMCLTVWWRYWFFS-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |