About (2E)-N-cyclopropyl-2-ethenyl-4-methylpenta-2,4-dienamide;ethane
(2E)-N-cyclopropyl-2-ethenyl-4-methylpenta-2,4-dienamide;ethane (PubChem CID 143520595) has the molecular formula C13H21NO
and a molecular weight of 207.32 g/mol. Its IUPAC name is (2E)-N-cyclopropyl-2-ethenyl-4-methylpenta-2,4-dienamide;ethane.
Molecular Properties
| Compound Name | (2E)-N-cyclopropyl-2-ethenyl-4-methylpenta-2,4-dienamide;ethane |
| PubChem CID | 143520595 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (2E)-N-cyclopropyl-2-ethenyl-4-methylpenta-2,4-dienamide;ethane |
| SMILES | C=C/C(=C\C(=C)C)C(=O)NC1CC1.CC |
| InChI | InChI=1S/C11H15NO.C2H6/c1-4-9(7-8(2)3)11(13)12-10-5-6-10;1-2/h4,7,10H,1-2,5-6H2,3H3,(H,12,13);1-2H3/b9-7+; |
| InChIKey | JSARSQRVZDHQMO-BXTVWIJMSA-N |
| XLogP | 2.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-N-cyclopropyl-2-ethenyl-4-methylpenta-2,4-dienamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-N-cyclopropyl-2-ethenyl-4-methylpenta-2,4-dienamide;ethane?
The IUPAC name of (2E)-N-cyclopropyl-2-ethenyl-4-methylpenta-2,4-dienamide;ethane (CID 143520595) is (2E)-N-cyclopropyl-2-ethenyl-4-methylpenta-2,4-dienamide;ethane.
What is the SMILES notation for (2E)-N-cyclopropyl-2-ethenyl-4-methylpenta-2,4-dienamide;ethane?
The canonical SMILES for (2E)-N-cyclopropyl-2-ethenyl-4-methylpenta-2,4-dienamide;ethane is C=C/C(=C\C(=C)C)C(=O)NC1CC1.CC.
What is the InChIKey of (2E)-N-cyclopropyl-2-ethenyl-4-methylpenta-2,4-dienamide;ethane?
The InChIKey is JSARSQRVZDHQMO-BXTVWIJMSA-N. The full InChI is InChI=1S/C11H15NO.C2H6/c1-4-9(7-8(2)3)11(13)12-10-5-6-10;1-2/h4,7,10H,1-2,5-6H2,3H3,(H,12,13);1-2H3/b9-7+;.
What are the key properties of (2E)-N-cyclopropyl-2-ethenyl-4-methylpenta-2,4-dienamide;ethane?
(2E)-N-cyclopropyl-2-ethenyl-4-methylpenta-2,4-dienamide;ethane has a molecular weight of 207.32 g/mol, XLogP of 2.98, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-N-cyclopropyl-2-ethenyl-4-methylpenta-2,4-dienamide;ethane is sourced from PubChem (CID 143520595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).