About 5-ethenyl-4-methyl-6-[(Z)-prop-1-enyl]-2,3-dihydro-1,4-thiazine 1-oxide
5-ethenyl-4-methyl-6-[(Z)-prop-1-enyl]-2,3-dihydro-1,4-thiazine 1-oxide (PubChem CID 143520601) has the molecular formula C10H15NOS
and a molecular weight of 197.30 g/mol. Its IUPAC name is 5-ethenyl-4-methyl-6-[(Z)-prop-1-enyl]-2,3-dihydro-1,4-thiazine 1-oxide.
Molecular Properties
| Compound Name | 5-ethenyl-4-methyl-6-[(Z)-prop-1-enyl]-2,3-dihydro-1,4-thiazine 1-oxide |
| PubChem CID | 143520601 |
| Molecular Formula | C10H15NOS |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 5-ethenyl-4-methyl-6-[(Z)-prop-1-enyl]-2,3-dihydro-1,4-thiazine 1-oxide |
| SMILES | C=CC1=C(/C=C\C)S(=O)CCN1C |
| InChI | InChI=1S/C10H15NOS/c1-4-6-10-9(5-2)11(3)7-8-13(10)12/h4-6H,2,7-8H2,1,3H3/b6-4- |
| InChIKey | NQMPXCZNNIISAE-XQRVVYSFSA-N |
| XLogP | 1.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethenyl-4-methyl-6-[(Z)-prop-1-enyl]-2,3-dihydro-1,4-thiazine 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-4-methyl-6-[(Z)-prop-1-enyl]-2,3-dihydro-1,4-thiazine 1-oxide?
The IUPAC name of 5-ethenyl-4-methyl-6-[(Z)-prop-1-enyl]-2,3-dihydro-1,4-thiazine 1-oxide (CID 143520601) is 5-ethenyl-4-methyl-6-[(Z)-prop-1-enyl]-2,3-dihydro-1,4-thiazine 1-oxide.
What is the SMILES notation for 5-ethenyl-4-methyl-6-[(Z)-prop-1-enyl]-2,3-dihydro-1,4-thiazine 1-oxide?
The canonical SMILES for 5-ethenyl-4-methyl-6-[(Z)-prop-1-enyl]-2,3-dihydro-1,4-thiazine 1-oxide is C=CC1=C(/C=C\C)S(=O)CCN1C.
What is the InChIKey of 5-ethenyl-4-methyl-6-[(Z)-prop-1-enyl]-2,3-dihydro-1,4-thiazine 1-oxide?
The InChIKey is NQMPXCZNNIISAE-XQRVVYSFSA-N. The full InChI is InChI=1S/C10H15NOS/c1-4-6-10-9(5-2)11(3)7-8-13(10)12/h4-6H,2,7-8H2,1,3H3/b6-4-.
What are the key properties of 5-ethenyl-4-methyl-6-[(Z)-prop-1-enyl]-2,3-dihydro-1,4-thiazine 1-oxide?
5-ethenyl-4-methyl-6-[(Z)-prop-1-enyl]-2,3-dihydro-1,4-thiazine 1-oxide has a molecular weight of 197.30 g/mol, XLogP of 1.65, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-4-methyl-6-[(Z)-prop-1-enyl]-2,3-dihydro-1,4-thiazine 1-oxide is sourced from PubChem (CID 143520601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).