C12H19FN2 — CID 143520895
N'-[(3Z)-4-fluoro-3-prop-1-en-2-ylhexa-1,3,5-trien-2-yl]propane-1,3-diamine (PubChem CID 143520895) has the molecular formula C12H19FN2 and a molecular weight of 210.30 g/mol. Its IUPAC name is N'-[(3Z)-4-fluoro-3-prop-1-en-2-ylhexa-1,3,5-trien-2-yl]propane-1,3-diamine.
| Compound Name | N'-[(3Z)-4-fluoro-3-prop-1-en-2-ylhexa-1,3,5-trien-2-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 143520895 |
| Molecular Formula | C12H19FN2 |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | N'-[(3Z)-4-fluoro-3-prop-1-en-2-ylhexa-1,3,5-trien-2-yl]propane-1,3-diamine |
| SMILES | C=C/C(F)=C(\C(=C)C)C(=C)NCCCN |
| InChI | InChI=1S/C12H19FN2/c1-5-11(13)12(9(2)3)10(4)15-8-6-7-14/h5,15H,1-2,4,6-8,14H2,3H3/b12-11- |
| InChIKey | FTNKJSQRGFOSEU-QXMHVHEDSA-N |
| XLogP | 2.42 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|