C27H23N3O4 — CID 143521321
N-[(6,12-dioxo-5,11-dihydroquinolino[3,2-b]quinolin-2-yl)methyl]-N,2-dimethylbenzamide;formaldehyde (PubChem CID 143521321) has the molecular formula C27H23N3O4 and a molecular weight of 453.50 g/mol. Its IUPAC name is N-[(6,12-dioxo-5,11-dihydroquinolino[3,2-b]quinolin-2-yl)methyl]-N,2-dimethylbenzamide;formaldehyde.
| Compound Name | N-[(6,12-dioxo-5,11-dihydroquinolino[3,2-b]quinolin-2-yl)methyl]-N,2-dimethylbenzamide;formaldehyde |
|---|---|
| PubChem CID | 143521321 |
| Molecular Formula | C27H23N3O4 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | N-[(6,12-dioxo-5,11-dihydroquinolino[3,2-b]quinolin-2-yl)methyl]-N,2-dimethylbenzamide;formaldehyde |
| SMILES | C=O.Cc1ccccc1C(=O)N(C)Cc1ccc2[nH]c3c(=O)c4ccccc4[nH]c3c(=O)c2c1 |
| InChI | InChI=1S/C26H21N3O3.CH2O/c1-15-7-3-4-8-17(15)26(32)29(2)14-16-11-12-21-19(13-16)25(31)23-22(28-21)24(30)18-9-5-6-10-20(18)27-23;1-2/h3-13H,14H2,1-2H3,(H,27,30)(H,28,31);1H2 |
| InChIKey | HKOMLTPFGGRYSI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 103.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|