C23H18Cl6N4O4 — CID 143521325
2,2,2-trichloro-N-[[2-[2-(methylamino)-5-[[(2,2,2-trichloroacetyl)amino]methyl]benzoyl]-4-oxo-1H-quinolin-6-yl]methyl]acetamide (PubChem CID 143521325) has the molecular formula C23H18Cl6N4O4 and a molecular weight of 627.14 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[[2-[2-(methylamino)-5-[[(2,2,2-trichloroacetyl)amino]methyl]benzoyl]-4-oxo-1H-quinolin-6-yl]methyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[[2-[2-(methylamino)-5-[[(2,2,2-trichloroacetyl)amino]methyl]benzoyl]-4-oxo-1H-quinolin-6-yl]methyl]acetamide |
|---|---|
| PubChem CID | 143521325 |
| Molecular Formula | C23H18Cl6N4O4 |
| Molecular Weight | 627.14 g/mol |
| Exact Mass | 623.95 |
| IUPAC Name | 2,2,2-trichloro-N-[[2-[2-(methylamino)-5-[[(2,2,2-trichloroacetyl)amino]methyl]benzoyl]-4-oxo-1H-quinolin-6-yl]methyl]acetamide |
| SMILES | CNc1ccc(CNC(=O)C(Cl)(Cl)Cl)cc1C(=O)c1cc(=O)c2cc(CNC(=O)C(Cl)(Cl)Cl)ccc2[nH]1 |
| InChI | InChI=1S/C23H18Cl6N4O4/c1-30-15-4-2-12(10-32-21(37)23(27,28)29)7-14(15)19(35)17-8-18(34)13-6-11(3-5-16(13)33-17)9-31-20(36)22(24,25)26/h2-8,30H,9-10H2,1H3,(H,31,36)(H,32,37)(H,33,34) |
| InChIKey | DCAGNUHTNKFZOK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.14 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|