About (2-ethenyloxolan-2-yl)methanol;propane-2,2-diol
(2-ethenyloxolan-2-yl)methanol;propane-2,2-diol (PubChem CID 143521419) has the molecular formula C10H20O4
and a molecular weight of 204.27 g/mol. Its IUPAC name is (2-ethenyloxolan-2-yl)methanol;propane-2,2-diol.
Molecular Properties
| Compound Name | (2-ethenyloxolan-2-yl)methanol;propane-2,2-diol |
| PubChem CID | 143521419 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | (2-ethenyloxolan-2-yl)methanol;propane-2,2-diol |
| SMILES | C=CC1(CO)CCCO1.CC(C)(O)O |
| InChI | InChI=1S/C7H12O2.C3H8O2/c1-2-7(6-8)4-3-5-9-7;1-3(2,4)5/h2,8H,1,3-6H2;4-5H,1-2H3 |
| InChIKey | NDZVBXMOJURPTJ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2-ethenyloxolan-2-yl)methanol;propane-2,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethenyloxolan-2-yl)methanol;propane-2,2-diol?
The IUPAC name of (2-ethenyloxolan-2-yl)methanol;propane-2,2-diol (CID 143521419) is (2-ethenyloxolan-2-yl)methanol;propane-2,2-diol.
What is the SMILES notation for (2-ethenyloxolan-2-yl)methanol;propane-2,2-diol?
The canonical SMILES for (2-ethenyloxolan-2-yl)methanol;propane-2,2-diol is C=CC1(CO)CCCO1.CC(C)(O)O.
What is the InChIKey of (2-ethenyloxolan-2-yl)methanol;propane-2,2-diol?
The InChIKey is NDZVBXMOJURPTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.C3H8O2/c1-2-7(6-8)4-3-5-9-7;1-3(2,4)5/h2,8H,1,3-6H2;4-5H,1-2H3.
What are the key properties of (2-ethenyloxolan-2-yl)methanol;propane-2,2-diol?
(2-ethenyloxolan-2-yl)methanol;propane-2,2-diol has a molecular weight of 204.27 g/mol, XLogP of 0.42, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethenyloxolan-2-yl)methanol;propane-2,2-diol is sourced from PubChem (CID 143521419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).