C19H24N4 — CID 143522082
1-[(3E,6E)-2-amino-4,5-dimethylidene-3,6-bis(prop-2-enylidene)cyclohexen-1-yl]-2-but-3-enylguanidine (PubChem CID 143522082) has the molecular formula C19H24N4 and a molecular weight of 308.43 g/mol. Its IUPAC name is 1-[(3E,6E)-2-amino-4,5-dimethylidene-3,6-bis(prop-2-enylidene)cyclohexen-1-yl]-2-but-3-enylguanidine.
| Compound Name | 1-[(3E,6E)-2-amino-4,5-dimethylidene-3,6-bis(prop-2-enylidene)cyclohexen-1-yl]-2-but-3-enylguanidine |
|---|---|
| PubChem CID | 143522082 |
| Molecular Formula | C19H24N4 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 1-[(3E,6E)-2-amino-4,5-dimethylidene-3,6-bis(prop-2-enylidene)cyclohexen-1-yl]-2-but-3-enylguanidine |
| SMILES | C=C/C=c1/c(N)c(N/C(N)=N/CCC=C)/c(=C/C=C)c(=C)c1=C |
| InChI | InChI=1S/C19H24N4/c1-6-9-12-22-19(21)23-18-16(11-8-3)14(5)13(4)15(10-7-2)17(18)20/h6-8,10-11H,1-5,9,12,20H2,(H3,21,22,23)/b15-10+,16-11+ |
| InChIKey | UNHACEZEJCXZRA-RWPWKDLBSA-N |
| XLogP | 0.33 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|