C19H13ClIN3O — CID 143522406
3-(5-chloro-2-phenylmethoxyphenyl)-6-iodo-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 143522406) has the molecular formula C19H13ClIN3O and a molecular weight of 461.69 g/mol. Its IUPAC name is 3-(5-chloro-2-phenylmethoxyphenyl)-6-iodo-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-(5-chloro-2-phenylmethoxyphenyl)-6-iodo-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 143522406 |
| Molecular Formula | C19H13ClIN3O |
| Molecular Weight | 461.69 g/mol |
| Exact Mass | 460.98 |
| IUPAC Name | 3-(5-chloro-2-phenylmethoxyphenyl)-6-iodo-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | Clc1ccc(OCc2ccccc2)c(-c2nnc3ccc(I)cn23)c1 |
| InChI | InChI=1S/C19H13ClIN3O/c20-14-6-8-17(25-12-13-4-2-1-3-5-13)16(10-14)19-23-22-18-9-7-15(21)11-24(18)19/h1-11H,12H2 |
| InChIKey | GQRDKTINEMUAMT-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.69 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|