About methyl 7-[(5S)-2-acetyloxy-5-[4,4-difluoro-3-(hydroxymethyl)octyl]cyclopentyl]heptanoate
methyl 7-[(5S)-2-acetyloxy-5-[4,4-difluoro-3-(hydroxymethyl)octyl]cyclopentyl]heptanoate (PubChem CID 143522944) has the molecular formula C24H42F2O5
and a molecular weight of 448.59 g/mol. Its IUPAC name is methyl 7-[(5S)-2-acetyloxy-5-[4,4-difluoro-3-(hydroxymethyl)octyl]cyclopentyl]heptanoate.
Molecular Properties
| Compound Name | methyl 7-[(5S)-2-acetyloxy-5-[4,4-difluoro-3-(hydroxymethyl)octyl]cyclopentyl]heptanoate |
| PubChem CID | 143522944 |
| Molecular Formula | C24H42F2O5 |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | methyl 7-[(5S)-2-acetyloxy-5-[4,4-difluoro-3-(hydroxymethyl)octyl]cyclopentyl]heptanoate |
| SMILES | CCCCC(F)(F)C(CO)CC[C@H]1CCC(OC(C)=O)C1CCCCCCC(=O)OC |
| InChI | InChI=1S/C24H42F2O5/c1-4-5-16-24(25,26)20(17-27)14-12-19-13-15-22(31-18(2)28)21(19)10-8-6-7-9-11-23(29)30-3/h19-22,27H,4-17H2,1-3H3/t19-,20?,21?,22?/m0/s1 |
| InChIKey | YCSQXBWCJGDIRA-HNEARETJSA-N |
| XLogP | 5.67 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-[(5S)-2-acetyloxy-5-[4,4-difluoro-3-(hydroxymethyl)octyl]cyclopentyl]heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-[(5S)-2-acetyloxy-5-[4,4-difluoro-3-(hydroxymethyl)octyl]cyclopentyl]heptanoate?
The IUPAC name of methyl 7-[(5S)-2-acetyloxy-5-[4,4-difluoro-3-(hydroxymethyl)octyl]cyclopentyl]heptanoate (CID 143522944) is methyl 7-[(5S)-2-acetyloxy-5-[4,4-difluoro-3-(hydroxymethyl)octyl]cyclopentyl]heptanoate.
What is the SMILES notation for methyl 7-[(5S)-2-acetyloxy-5-[4,4-difluoro-3-(hydroxymethyl)octyl]cyclopentyl]heptanoate?
The canonical SMILES for methyl 7-[(5S)-2-acetyloxy-5-[4,4-difluoro-3-(hydroxymethyl)octyl]cyclopentyl]heptanoate is CCCCC(F)(F)C(CO)CC[C@H]1CCC(OC(C)=O)C1CCCCCCC(=O)OC.
What is the InChIKey of methyl 7-[(5S)-2-acetyloxy-5-[4,4-difluoro-3-(hydroxymethyl)octyl]cyclopentyl]heptanoate?
The InChIKey is YCSQXBWCJGDIRA-HNEARETJSA-N. The full InChI is InChI=1S/C24H42F2O5/c1-4-5-16-24(25,26)20(17-27)14-12-19-13-15-22(31-18(2)28)21(19)10-8-6-7-9-11-23(29)30-3/h19-22,27H,4-17H2,1-3H3/t19-,20?,21?,22?/m0/s1.
What are the key properties of methyl 7-[(5S)-2-acetyloxy-5-[4,4-difluoro-3-(hydroxymethyl)octyl]cyclopentyl]heptanoate?
methyl 7-[(5S)-2-acetyloxy-5-[4,4-difluoro-3-(hydroxymethyl)octyl]cyclopentyl]heptanoate has a molecular weight of 448.59 g/mol, XLogP of 5.67, 16 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-[(5S)-2-acetyloxy-5-[4,4-difluoro-3-(hydroxymethyl)octyl]cyclopentyl]heptanoate is sourced from PubChem (CID 143522944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).