C11H17NO3S — CID 143523155
ethyl (4Z,6E)-2-acetyl-7-amino-4-sulfanylhepta-4,6-dienoate (PubChem CID 143523155) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is ethyl (4Z,6E)-2-acetyl-7-amino-4-sulfanylhepta-4,6-dienoate.
| Compound Name | ethyl (4Z,6E)-2-acetyl-7-amino-4-sulfanylhepta-4,6-dienoate |
|---|---|
| PubChem CID | 143523155 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | ethyl (4Z,6E)-2-acetyl-7-amino-4-sulfanylhepta-4,6-dienoate |
| SMILES | CCOC(=O)C(C/C(S)=C/C=C/N)C(C)=O |
| InChI | InChI=1S/C11H17NO3S/c1-3-15-11(14)10(8(2)13)7-9(16)5-4-6-12/h4-6,10,16H,3,7,12H2,1-2H3/b6-4+,9-5- |
| InChIKey | XQQHCXQPQOULCA-FBTALVJDSA-N |
| XLogP | 1.43 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|