C11H16N2O — CID 143524389
ethane;2-[(3E)-hexa-1,3,5-trien-3-yl]-5-methyl-1,3,4-oxadiazole (PubChem CID 143524389) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is ethane;2-[(3E)-hexa-1,3,5-trien-3-yl]-5-methyl-1,3,4-oxadiazole.
| Compound Name | ethane;2-[(3E)-hexa-1,3,5-trien-3-yl]-5-methyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 143524389 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | ethane;2-[(3E)-hexa-1,3,5-trien-3-yl]-5-methyl-1,3,4-oxadiazole |
| SMILES | C=C/C=C(\C=C)c1nnc(C)o1.CC |
| InChI | InChI=1S/C9H10N2O.C2H6/c1-4-6-8(5-2)9-11-10-7(3)12-9;1-2/h4-6H,1-2H2,3H3;1-2H3/b8-6+; |
| InChIKey | ZCSMYPKEZODMNO-WVLIHFOGSA-N |
| XLogP | 3.16 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|