C16H19F3OS — CID 143524396
ethane;2-(methoxymethyl)-4-phenyl-6-(trifluoromethyl)-4H-thiopyran (PubChem CID 143524396) has the molecular formula C16H19F3OS and a molecular weight of 316.39 g/mol. Its IUPAC name is ethane;2-(methoxymethyl)-4-phenyl-6-(trifluoromethyl)-4H-thiopyran.
| Compound Name | ethane;2-(methoxymethyl)-4-phenyl-6-(trifluoromethyl)-4H-thiopyran |
|---|---|
| PubChem CID | 143524396 |
| Molecular Formula | C16H19F3OS |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | ethane;2-(methoxymethyl)-4-phenyl-6-(trifluoromethyl)-4H-thiopyran |
| SMILES | CC.COCC1=CC(c2ccccc2)C=C(C(F)(F)F)S1 |
| InChI | InChI=1S/C14H13F3OS.C2H6/c1-18-9-12-7-11(10-5-3-2-4-6-10)8-13(19-12)14(15,16)17;1-2/h2-8,11H,9H2,1H3;1-2H3 |
| InChIKey | BTSWCEXTJVCQDJ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |