C12H18N2O — CID 143524446
4-methyl-3-(pyridin-4-ylmethylamino)pentan-2-one (PubChem CID 143524446) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 4-methyl-3-(pyridin-4-ylmethylamino)pentan-2-one.
| Compound Name | 4-methyl-3-(pyridin-4-ylmethylamino)pentan-2-one |
|---|---|
| PubChem CID | 143524446 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 4-methyl-3-(pyridin-4-ylmethylamino)pentan-2-one |
| SMILES | CC(=O)C(NCc1ccncc1)C(C)C |
| InChI | InChI=1S/C12H18N2O/c1-9(2)12(10(3)15)14-8-11-4-6-13-7-5-11/h4-7,9,12,14H,8H2,1-3H3 |
| InChIKey | MXSFHKGIYMQSCX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |