C28H43ClFNO2 — CID 143524545
(2S,3R)-1-[4-(4-chlorocyclohexyl)piperidin-1-yl]-2-[3-(4-ethenyl-3-fluorocyclohexen-1-yl)-3-hydroxyprop-1-en-2-yl]-3-methylpentan-1-one (PubChem CID 143524545) has the molecular formula C28H43ClFNO2 and a molecular weight of 480.11 g/mol. Its IUPAC name is (2S,3R)-1-[4-(4-chlorocyclohexyl)piperidin-1-yl]-2-[3-(4-ethenyl-3-fluorocyclohexen-1-yl)-3-hydroxyprop-1-en-2-yl]-3-methylpentan-1-one.
| Compound Name | (2S,3R)-1-[4-(4-chlorocyclohexyl)piperidin-1-yl]-2-[3-(4-ethenyl-3-fluorocyclohexen-1-yl)-3-hydroxyprop-1-en-2-yl]-3-methylpentan-1-one |
|---|---|
| PubChem CID | 143524545 |
| Molecular Formula | C28H43ClFNO2 |
| Molecular Weight | 480.11 g/mol |
| Exact Mass | 479.30 |
| IUPAC Name | (2S,3R)-1-[4-(4-chlorocyclohexyl)piperidin-1-yl]-2-[3-(4-ethenyl-3-fluorocyclohexen-1-yl)-3-hydroxyprop-1-en-2-yl]-3-methylpentan-1-one |
| SMILES | C=CC1CCC(C(O)C(=C)[C@@H](C(=O)N2CCC(C3CCC(Cl)CC3)CC2)[C@H](C)CC)=CC1F |
| InChI | InChI=1S/C28H43ClFNO2/c1-5-18(3)26(19(4)27(32)23-8-7-20(6-2)25(30)17-23)28(33)31-15-13-22(14-16-31)21-9-11-24(29)12-10-21/h6,17-18,20-22,24-27,32H,2,4-5,7-16H2,1,3H3/t18-,20?,21?,24?,25?,26+,27?/m1/s1 |
| InChIKey | XYMVVZVCQJMWMD-NBDLCMAWSA-N |
| XLogP | 6.46 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.11 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|