About CID 143524709
CID 143524709 (PubChem CID 143524709) has the molecular formula C25H42NO
and a molecular weight of 372.62 g/mol.
Molecular Properties
| Compound Name | CID 143524709 |
| PubChem CID | 143524709 |
| Molecular Formula | C25H42NO |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.33 |
| IUPAC Name | — |
| SMILES | CC1=CC=C(C2CCC(C[C@H](NCC3(C(C)O)CC3)C(C)C)CC2(C)C)[CH]1 |
| InChI | InChI=1S/C25H42NO/c1-17(2)23(26-16-25(11-12-25)19(4)27)14-20-8-10-22(24(5,6)15-20)21-9-7-18(3)13-21/h7,9,13,17,19-20,22-23,26-27H,8,10-12,14-16H2,1-6H3/t19?,20?,22?,23-/m0/s1 |
| InChIKey | RWICUNYWBJUQIO-XJBJGSKASA-N |
| XLogP | 5.68 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 143524709 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 143524709?
The IUPAC name of CID 143524709 (CID 143524709) is not available.
What is the SMILES notation for CID 143524709?
The canonical SMILES for CID 143524709 is CC1=CC=C(C2CCC(C[C@H](NCC3(C(C)O)CC3)C(C)C)CC2(C)C)[CH]1.
What is the InChIKey of CID 143524709?
The InChIKey is RWICUNYWBJUQIO-XJBJGSKASA-N. The full InChI is InChI=1S/C25H42NO/c1-17(2)23(26-16-25(11-12-25)19(4)27)14-20-8-10-22(24(5,6)15-20)21-9-7-18(3)13-21/h7,9,13,17,19-20,22-23,26-27H,8,10-12,14-16H2,1-6H3/t19?,20?,22?,23-/m0/s1.
What are the key properties of CID 143524709?
CID 143524709 has a molecular weight of 372.62 g/mol, XLogP of 5.68, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 143524709 is sourced from PubChem (CID 143524709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).