C25H43ClN2O — CID 143524883
[[(3R)-2-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-4-methylpentan-3-yl]amino]-cyclopent-3-en-1-ylmethanol (PubChem CID 143524883) has the molecular formula C25H43ClN2O and a molecular weight of 423.09 g/mol. Its IUPAC name is [[(3R)-2-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-4-methylpentan-3-yl]amino]-cyclopent-3-en-1-ylmethanol.
| Compound Name | [[(3R)-2-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-4-methylpentan-3-yl]amino]-cyclopent-3-en-1-ylmethanol |
|---|---|
| PubChem CID | 143524883 |
| Molecular Formula | C25H43ClN2O |
| Molecular Weight | 423.09 g/mol |
| Exact Mass | 422.31 |
| IUPAC Name | [[(3R)-2-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-4-methylpentan-3-yl]amino]-cyclopent-3-en-1-ylmethanol |
| SMILES | CC(C)[C@@H](NC(O)C1CC=CC1)C(C)N1CCC(C2=CCC(Cl)CC2)C(C)(C)C1 |
| InChI | InChI=1S/C25H43ClN2O/c1-17(2)23(27-24(29)20-8-6-7-9-20)18(3)28-15-14-22(25(4,5)16-28)19-10-12-21(26)13-11-19/h6-7,10,17-18,20-24,27,29H,8-9,11-16H2,1-5H3/t18?,21?,22?,23-,24?/m1/s1 |
| InChIKey | UEJKKWPTQFFWMM-IODYJVJSSA-N |
| XLogP | 5.34 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.09 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|