C25H40ClF2NO2 — CID 143525052
(2R)-1-[4-(4-chloro-3-fluorocyclohexyl)cyclohexyl]-2-[[2-(4-fluorocyclohexa-1,5-dien-1-yl)-1-hydroxyethyl]amino]-3-methylbutan-1-ol (PubChem CID 143525052) has the molecular formula C25H40ClF2NO2 and a molecular weight of 460.05 g/mol. Its IUPAC name is (2R)-1-[4-(4-chloro-3-fluorocyclohexyl)cyclohexyl]-2-[[2-(4-fluorocyclohexa-1,5-dien-1-yl)-1-hydroxyethyl]amino]-3-methylbutan-1-ol.
| Compound Name | (2R)-1-[4-(4-chloro-3-fluorocyclohexyl)cyclohexyl]-2-[[2-(4-fluorocyclohexa-1,5-dien-1-yl)-1-hydroxyethyl]amino]-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 143525052 |
| Molecular Formula | C25H40ClF2NO2 |
| Molecular Weight | 460.05 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | (2R)-1-[4-(4-chloro-3-fluorocyclohexyl)cyclohexyl]-2-[[2-(4-fluorocyclohexa-1,5-dien-1-yl)-1-hydroxyethyl]amino]-3-methylbutan-1-ol |
| SMILES | CC(C)[C@@H](NC(O)CC1=CCC(F)C=C1)C(O)C1CCC(C2CCC(Cl)C(F)C2)CC1 |
| InChI | InChI=1S/C25H40ClF2NO2/c1-15(2)24(29-23(30)13-16-3-10-20(27)11-4-16)25(31)18-7-5-17(6-8-18)19-9-12-21(26)22(28)14-19/h3-4,10,15,17-25,29-31H,5-9,11-14H2,1-2H3/t17?,18?,19?,20?,21?,22?,23?,24-,25?/m1/s1 |
| InChIKey | BTPJLFVJRSVLST-WFBIDLFLSA-N |
| XLogP | 5.45 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.05 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|