C12H22N2O — CID 143525197
(2Z,4E)-4-(morpholin-4-ylmethyl)hepta-2,4-dien-1-amine (PubChem CID 143525197) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is (2Z,4E)-4-(morpholin-4-ylmethyl)hepta-2,4-dien-1-amine.
| Compound Name | (2Z,4E)-4-(morpholin-4-ylmethyl)hepta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 143525197 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | (2Z,4E)-4-(morpholin-4-ylmethyl)hepta-2,4-dien-1-amine |
| SMILES | CC/C=C(\C=C/CN)CN1CCOCC1 |
| InChI | InChI=1S/C12H22N2O/c1-2-4-12(5-3-6-13)11-14-7-9-15-10-8-14/h3-5H,2,6-11,13H2,1H3/b5-3-,12-4+ |
| InChIKey | IGIYGYKQZIXTBH-BVEFSZSYSA-N |
| XLogP | 1.17 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|