About 1-[(2R)-2,5-dihydrofuran-2-yl]propan-2-one
1-[(2R)-2,5-dihydrofuran-2-yl]propan-2-one (PubChem CID 14352522) has the molecular formula C7H10O2
and a molecular weight of 126.15 g/mol. Its IUPAC name is 1-[(2R)-2,5-dihydrofuran-2-yl]propan-2-one.
Molecular Properties
| Compound Name | 1-[(2R)-2,5-dihydrofuran-2-yl]propan-2-one |
| PubChem CID | 14352522 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | 1-[(2R)-2,5-dihydrofuran-2-yl]propan-2-one |
| SMILES | CC(=O)C[C@@H]1C=CCO1 |
| InChI | InChI=1S/C7H10O2/c1-6(8)5-7-3-2-4-9-7/h2-3,7H,4-5H2,1H3/t7-/m0/s1 |
| InChIKey | AEJCBANCTMGQHU-ZETCQYMHSA-N |
| XLogP | 0.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2R)-2,5-dihydrofuran-2-yl]propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2R)-2,5-dihydrofuran-2-yl]propan-2-one?
The IUPAC name of 1-[(2R)-2,5-dihydrofuran-2-yl]propan-2-one (CID 14352522) is 1-[(2R)-2,5-dihydrofuran-2-yl]propan-2-one.
What is the SMILES notation for 1-[(2R)-2,5-dihydrofuran-2-yl]propan-2-one?
The canonical SMILES for 1-[(2R)-2,5-dihydrofuran-2-yl]propan-2-one is CC(=O)C[C@@H]1C=CCO1.
What is the InChIKey of 1-[(2R)-2,5-dihydrofuran-2-yl]propan-2-one?
The InChIKey is AEJCBANCTMGQHU-ZETCQYMHSA-N. The full InChI is InChI=1S/C7H10O2/c1-6(8)5-7-3-2-4-9-7/h2-3,7H,4-5H2,1H3/t7-/m0/s1.
What are the key properties of 1-[(2R)-2,5-dihydrofuran-2-yl]propan-2-one?
1-[(2R)-2,5-dihydrofuran-2-yl]propan-2-one has a molecular weight of 126.15 g/mol, XLogP of 0.92, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2R)-2,5-dihydrofuran-2-yl]propan-2-one is sourced from PubChem (CID 14352522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).