C32H43N3O2S — CID 143525560
2-[4-(5-butan-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl)-3-methylsulfanylphenyl]-6-[2-(oxolan-2-yl)ethyl]-3,4-dihydroisoquinolin-1-one (PubChem CID 143525560) has the molecular formula C32H43N3O2S and a molecular weight of 533.78 g/mol. Its IUPAC name is 2-[4-(5-butan-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl)-3-methylsulfanylphenyl]-6-[2-(oxolan-2-yl)ethyl]-3,4-dihydroisoquinolin-1-one.
| Compound Name | 2-[4-(5-butan-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl)-3-methylsulfanylphenyl]-6-[2-(oxolan-2-yl)ethyl]-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 143525560 |
| Molecular Formula | C32H43N3O2S |
| Molecular Weight | 533.78 g/mol |
| Exact Mass | 533.31 |
| IUPAC Name | 2-[4-(5-butan-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl)-3-methylsulfanylphenyl]-6-[2-(oxolan-2-yl)ethyl]-3,4-dihydroisoquinolin-1-one |
| SMILES | CCC(C)N1CC2CCN(c3ccc(N4CCc5cc(CCC6CCCO6)ccc5C4=O)cc3SC)C2C1 |
| InChI | InChI=1S/C32H43N3O2S/c1-4-22(2)33-20-25-14-16-35(30(25)21-33)29-12-9-26(19-31(29)38-3)34-15-13-24-18-23(8-11-28(24)32(34)36)7-10-27-6-5-17-37-27/h8-9,11-12,18-19,22,25,27,30H,4-7,10,13-17,20-21H2,1-3H3 |
| InChIKey | UNLAIRKXOUVOGZ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.78 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |