About [(3Z)-5-methylidene-7-oxohepta-1,3-dien-2-yl]azanium
[(3Z)-5-methylidene-7-oxohepta-1,3-dien-2-yl]azanium (PubChem CID 143526016) has the molecular formula C8H12NO+
and a molecular weight of 138.19 g/mol. Its IUPAC name is [(3Z)-5-methylidene-7-oxohepta-1,3-dien-2-yl]azanium.
Molecular Properties
| Compound Name | [(3Z)-5-methylidene-7-oxohepta-1,3-dien-2-yl]azanium |
| PubChem CID | 143526016 |
| Molecular Formula | C8H12NO+ |
| Molecular Weight | 138.19 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | [(3Z)-5-methylidene-7-oxohepta-1,3-dien-2-yl]azanium |
| SMILES | C=C([NH3+])/C=C\C(=C)CC=O |
| InChI | InChI=1S/C8H11NO/c1-7(5-6-10)3-4-8(2)9/h3-4,6H,1-2,5,9H2/p+1/b4-3- |
| InChIKey | ZENURXLFZUDTMS-ARJAWSKDSA-O |
| XLogP | 0.44 |
| TPSA | 44.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.19 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(3Z)-5-methylidene-7-oxohepta-1,3-dien-2-yl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3Z)-5-methylidene-7-oxohepta-1,3-dien-2-yl]azanium?
The IUPAC name of [(3Z)-5-methylidene-7-oxohepta-1,3-dien-2-yl]azanium (CID 143526016) is [(3Z)-5-methylidene-7-oxohepta-1,3-dien-2-yl]azanium.
What is the SMILES notation for [(3Z)-5-methylidene-7-oxohepta-1,3-dien-2-yl]azanium?
The canonical SMILES for [(3Z)-5-methylidene-7-oxohepta-1,3-dien-2-yl]azanium is C=C([NH3+])/C=C\C(=C)CC=O.
What is the InChIKey of [(3Z)-5-methylidene-7-oxohepta-1,3-dien-2-yl]azanium?
The InChIKey is ZENURXLFZUDTMS-ARJAWSKDSA-O. The full InChI is InChI=1S/C8H11NO/c1-7(5-6-10)3-4-8(2)9/h3-4,6H,1-2,5,9H2/p+1/b4-3-.
What are the key properties of [(3Z)-5-methylidene-7-oxohepta-1,3-dien-2-yl]azanium?
[(3Z)-5-methylidene-7-oxohepta-1,3-dien-2-yl]azanium has a molecular weight of 138.19 g/mol, XLogP of 0.44, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(3Z)-5-methylidene-7-oxohepta-1,3-dien-2-yl]azanium is sourced from PubChem (CID 143526016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).